C14H21N3O3 — CID 82368065
3-N,3-N-bis(2-methoxyethyl)-2H-1,4-benzoxazine-3,6-diamine (PubChem CID 82368065) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-N,3-N-bis(2-methoxyethyl)-2H-1,4-benzoxazine-3,6-diamine.
| Compound Name | 3-N,3-N-bis(2-methoxyethyl)-2H-1,4-benzoxazine-3,6-diamine |
|---|---|
| PubChem CID | 82368065 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 3-N,3-N-bis(2-methoxyethyl)-2H-1,4-benzoxazine-3,6-diamine |
| SMILES | COCCN(CCOC)C1=Nc2cc(N)ccc2OC1 |
| InChI | InChI=1S/C14H21N3O3/c1-18-7-5-17(6-8-19-2)14-10-20-13-4-3-11(15)9-12(13)16-14/h3-4,9H,5-8,10,15H2,1-2H3 |
| InChIKey | GAKZLWMSZSIBRV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|