C12H18Cl2N2O2 — CID 106890000
2,6-dichloro-1-N,1-N-bis(2-methoxyethyl)benzene-1,4-diamine (PubChem CID 106890000) has the molecular formula C12H18Cl2N2O2 and a molecular weight of 293.19 g/mol. Its IUPAC name is 2,6-dichloro-1-N,1-N-bis(2-methoxyethyl)benzene-1,4-diamine.
| Compound Name | 2,6-dichloro-1-N,1-N-bis(2-methoxyethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 106890000 |
| Molecular Formula | C12H18Cl2N2O2 |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2,6-dichloro-1-N,1-N-bis(2-methoxyethyl)benzene-1,4-diamine |
| SMILES | COCCN(CCOC)c1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C12H18Cl2N2O2/c1-17-5-3-16(4-6-18-2)12-10(13)7-9(15)8-11(12)14/h7-8H,3-6,15H2,1-2H3 |
| InChIKey | HXRKJEWGFAROFZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|