C13H19Cl2NO2 — CID 114067710
2-chloro-6-(chloromethyl)-N,N-bis(2-methoxyethyl)aniline (PubChem CID 114067710) has the molecular formula C13H19Cl2NO2 and a molecular weight of 292.21 g/mol. Its IUPAC name is 2-chloro-6-(chloromethyl)-N,N-bis(2-methoxyethyl)aniline.
| Compound Name | 2-chloro-6-(chloromethyl)-N,N-bis(2-methoxyethyl)aniline |
|---|---|
| PubChem CID | 114067710 |
| Molecular Formula | C13H19Cl2NO2 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-chloro-6-(chloromethyl)-N,N-bis(2-methoxyethyl)aniline |
| SMILES | COCCN(CCOC)c1c(Cl)cccc1CCl |
| InChI | InChI=1S/C13H19Cl2NO2/c1-17-8-6-16(7-9-18-2)13-11(10-14)4-3-5-12(13)15/h3-5H,6-10H2,1-2H3 |
| InChIKey | XFNLUXJAFYDYEG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|