C14H22Cl2N2O — CID 106890192
2,6-dichloro-1-N-(2-methoxyethyl)-1-N-pentan-3-ylbenzene-1,4-diamine (PubChem CID 106890192) has the molecular formula C14H22Cl2N2O and a molecular weight of 305.25 g/mol. Its IUPAC name is 2,6-dichloro-1-N-(2-methoxyethyl)-1-N-pentan-3-ylbenzene-1,4-diamine.
| Compound Name | 2,6-dichloro-1-N-(2-methoxyethyl)-1-N-pentan-3-ylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 106890192 |
| Molecular Formula | C14H22Cl2N2O |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2,6-dichloro-1-N-(2-methoxyethyl)-1-N-pentan-3-ylbenzene-1,4-diamine |
| SMILES | CCC(CC)N(CCOC)c1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C14H22Cl2N2O/c1-4-11(5-2)18(6-7-19-3)14-12(15)8-10(17)9-13(14)16/h8-9,11H,4-7,17H2,1-3H3 |
| InChIKey | GUSLHQHLBNWECZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|