C14H23BrN2O — CID 65342498
4-bromo-2-N-(2-methoxyethyl)-2-N-pentan-3-ylbenzene-1,2-diamine (PubChem CID 65342498) has the molecular formula C14H23BrN2O and a molecular weight of 315.25 g/mol. Its IUPAC name is 4-bromo-2-N-(2-methoxyethyl)-2-N-pentan-3-ylbenzene-1,2-diamine.
| Compound Name | 4-bromo-2-N-(2-methoxyethyl)-2-N-pentan-3-ylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 65342498 |
| Molecular Formula | C14H23BrN2O |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 4-bromo-2-N-(2-methoxyethyl)-2-N-pentan-3-ylbenzene-1,2-diamine |
| SMILES | CCC(CC)N(CCOC)c1cc(Br)ccc1N |
| InChI | InChI=1S/C14H23BrN2O/c1-4-12(5-2)17(8-9-18-3)14-10-11(15)6-7-13(14)16/h6-7,10,12H,4-5,8-9,16H2,1-3H3 |
| InChIKey | NBIGOMKUNCKMQT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|