C13H23N3O — CID 55004103
4-N-(2-methoxyethyl)-4-N-pentan-3-ylpyridine-3,4-diamine (PubChem CID 55004103) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 4-N-(2-methoxyethyl)-4-N-pentan-3-ylpyridine-3,4-diamine.
| Compound Name | 4-N-(2-methoxyethyl)-4-N-pentan-3-ylpyridine-3,4-diamine |
|---|---|
| PubChem CID | 55004103 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 4-N-(2-methoxyethyl)-4-N-pentan-3-ylpyridine-3,4-diamine |
| SMILES | CCC(CC)N(CCOC)c1ccncc1N |
| InChI | InChI=1S/C13H23N3O/c1-4-11(5-2)16(8-9-17-3)13-6-7-15-10-12(13)14/h6-7,10-11H,4-5,8-9,14H2,1-3H3 |
| InChIKey | YRWOUAZITBXOJF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |