C9H15N3O — CID 61360000
4-N-(2-methoxyethyl)-4-N-methylpyridine-3,4-diamine (PubChem CID 61360000) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 4-N-(2-methoxyethyl)-4-N-methylpyridine-3,4-diamine.
| Compound Name | 4-N-(2-methoxyethyl)-4-N-methylpyridine-3,4-diamine |
|---|---|
| PubChem CID | 61360000 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 4-N-(2-methoxyethyl)-4-N-methylpyridine-3,4-diamine |
| SMILES | COCCN(C)c1ccncc1N |
| InChI | InChI=1S/C9H15N3O/c1-12(5-6-13-2)9-3-4-11-7-8(9)10/h3-4,7H,5-6,10H2,1-2H3 |
| InChIKey | WDKOUGACYPBZTQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |