C7H11N3 — CID 14088946
4-N,4-N-dimethylpyridine-3,4-diamine (PubChem CID 14088946) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 4-N,4-N-dimethylpyridine-3,4-diamine.
| Compound Name | 4-N,4-N-dimethylpyridine-3,4-diamine |
|---|---|
| PubChem CID | 14088946 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 4-N,4-N-dimethylpyridine-3,4-diamine |
| SMILES | CN(C)c1ccncc1N |
| InChI | InChI=1S/C7H11N3/c1-10(2)7-3-4-9-5-6(7)8/h3-5H,8H2,1-2H3 |
| InChIKey | MATHJYKIAVEEOL-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |