C9H13BrN2O — CID 130512874
4-bromo-2-N-ethyl-2-N-methoxybenzene-1,2-diamine (PubChem CID 130512874) has the molecular formula C9H13BrN2O and a molecular weight of 245.12 g/mol. Its IUPAC name is 4-bromo-2-N-ethyl-2-N-methoxybenzene-1,2-diamine.
| Compound Name | 4-bromo-2-N-ethyl-2-N-methoxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 130512874 |
| Molecular Formula | C9H13BrN2O |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 4-bromo-2-N-ethyl-2-N-methoxybenzene-1,2-diamine |
| SMILES | CCN(OC)c1cc(Br)ccc1N |
| InChI | InChI=1S/C9H13BrN2O/c1-3-12(13-2)9-6-7(10)4-5-8(9)11/h4-6H,3,11H2,1-2H3 |
| InChIKey | ZTGFKZLIQQTDRQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|