C11H15BrN2 — CID 65343619
4-bromo-2-N-cyclopropyl-2-N-ethylbenzene-1,2-diamine (PubChem CID 65343619) has the molecular formula C11H15BrN2 and a molecular weight of 255.16 g/mol. Its IUPAC name is 4-bromo-2-N-cyclopropyl-2-N-ethylbenzene-1,2-diamine.
| Compound Name | 4-bromo-2-N-cyclopropyl-2-N-ethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 65343619 |
| Molecular Formula | C11H15BrN2 |
| Molecular Weight | 255.16 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 4-bromo-2-N-cyclopropyl-2-N-ethylbenzene-1,2-diamine |
| SMILES | CCN(c1cc(Br)ccc1N)C1CC1 |
| InChI | InChI=1S/C11H15BrN2/c1-2-14(9-4-5-9)11-7-8(12)3-6-10(11)13/h3,6-7,9H,2,4-5,13H2,1H3 |
| InChIKey | KMPKHNYCHWMIBS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.16 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|