C12H17BrN2 — CID 43264393
2-(aminomethyl)-5-bromo-N-cyclopropyl-N-ethylaniline (PubChem CID 43264393) has the molecular formula C12H17BrN2 and a molecular weight of 269.19 g/mol. Its IUPAC name is 2-(aminomethyl)-5-bromo-N-cyclopropyl-N-ethylaniline.
| Compound Name | 2-(aminomethyl)-5-bromo-N-cyclopropyl-N-ethylaniline |
|---|---|
| PubChem CID | 43264393 |
| Molecular Formula | C12H17BrN2 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2-(aminomethyl)-5-bromo-N-cyclopropyl-N-ethylaniline |
| SMILES | CCN(c1cc(Br)ccc1CN)C1CC1 |
| InChI | InChI=1S/C12H17BrN2/c1-2-15(11-5-6-11)12-7-10(13)4-3-9(12)8-14/h3-4,7,11H,2,5-6,8,14H2,1H3 |
| InChIKey | NSWGXAMOEXOOCF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |