C18H24N2O4 — CID 18371496
5-[5-amino-2-[bis(2-methoxyethyl)amino]phenyl]benzene-1,3-diol (PubChem CID 18371496) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 5-[5-amino-2-[bis(2-methoxyethyl)amino]phenyl]benzene-1,3-diol.
| Compound Name | 5-[5-amino-2-[bis(2-methoxyethyl)amino]phenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 18371496 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 5-[5-amino-2-[bis(2-methoxyethyl)amino]phenyl]benzene-1,3-diol |
| SMILES | COCCN(CCOC)c1ccc(N)cc1-c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C18H24N2O4/c1-23-7-5-20(6-8-24-2)18-4-3-14(19)11-17(18)13-9-15(21)12-16(22)10-13/h3-4,9-12,21-22H,5-8,19H2,1-2H3 |
| InChIKey | MNDNVZBITGNTBZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|