C18H23ClN2O2 — CID 18371415
2-(3-chlorophenyl)-1-N,1-N-bis(2-methoxyethyl)benzene-1,4-diamine (PubChem CID 18371415) has the molecular formula C18H23ClN2O2 and a molecular weight of 334.85 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-N,1-N-bis(2-methoxyethyl)benzene-1,4-diamine.
| Compound Name | 2-(3-chlorophenyl)-1-N,1-N-bis(2-methoxyethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 18371415 |
| Molecular Formula | C18H23ClN2O2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 2-(3-chlorophenyl)-1-N,1-N-bis(2-methoxyethyl)benzene-1,4-diamine |
| SMILES | COCCN(CCOC)c1ccc(N)cc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H23ClN2O2/c1-22-10-8-21(9-11-23-2)18-7-6-16(20)13-17(18)14-4-3-5-15(19)12-14/h3-7,12-13H,8-11,20H2,1-2H3 |
| InChIKey | WWBNKXNUARAVDS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|