About 3-pyrrolidin-1-yl-2H-1,4-benzoxazin-6-ol
3-pyrrolidin-1-yl-2H-1,4-benzoxazin-6-ol (PubChem CID 115030561) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-pyrrolidin-1-yl-2H-1,4-benzoxazin-6-ol.
Molecular Properties
| Compound Name | 3-pyrrolidin-1-yl-2H-1,4-benzoxazin-6-ol |
| PubChem CID | 115030561 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 3-pyrrolidin-1-yl-2H-1,4-benzoxazin-6-ol |
| SMILES | Oc1ccc2c(c1)N=C(N1CCCC1)CO2 |
| InChI | InChI=1S/C12H14N2O2/c15-9-3-4-11-10(7-9)13-12(8-16-11)14-5-1-2-6-14/h3-4,7,15H,1-2,5-6,8H2 |
| InChIKey | YZFBPLYTVDEWMN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-pyrrolidin-1-yl-2H-1,4-benzoxazin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrrolidin-1-yl-2H-1,4-benzoxazin-6-ol?
The IUPAC name of 3-pyrrolidin-1-yl-2H-1,4-benzoxazin-6-ol (CID 115030561) is 3-pyrrolidin-1-yl-2H-1,4-benzoxazin-6-ol.
What is the SMILES notation for 3-pyrrolidin-1-yl-2H-1,4-benzoxazin-6-ol?
The canonical SMILES for 3-pyrrolidin-1-yl-2H-1,4-benzoxazin-6-ol is Oc1ccc2c(c1)N=C(N1CCCC1)CO2.
What is the InChIKey of 3-pyrrolidin-1-yl-2H-1,4-benzoxazin-6-ol?
The InChIKey is YZFBPLYTVDEWMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2/c15-9-3-4-11-10(7-9)13-12(8-16-11)14-5-1-2-6-14/h3-4,7,15H,1-2,5-6,8H2.
What are the key properties of 3-pyrrolidin-1-yl-2H-1,4-benzoxazin-6-ol?
3-pyrrolidin-1-yl-2H-1,4-benzoxazin-6-ol has a molecular weight of 218.26 g/mol, XLogP of 1.91, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrrolidin-1-yl-2H-1,4-benzoxazin-6-ol is sourced from PubChem (CID 115030561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).