C14H11ClFN3O — CID 82368442
3-N-(3-chloro-4-fluorophenyl)-2H-1,4-benzoxazine-3,7-diamine (PubChem CID 82368442) has the molecular formula C14H11ClFN3O and a molecular weight of 291.71 g/mol. Its IUPAC name is 3-N-(3-chloro-4-fluorophenyl)-2H-1,4-benzoxazine-3,7-diamine.
| Compound Name | 3-N-(3-chloro-4-fluorophenyl)-2H-1,4-benzoxazine-3,7-diamine |
|---|---|
| PubChem CID | 82368442 |
| Molecular Formula | C14H11ClFN3O |
| Molecular Weight | 291.71 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 3-N-(3-chloro-4-fluorophenyl)-2H-1,4-benzoxazine-3,7-diamine |
| SMILES | Nc1ccc2c(c1)OCC(Nc1ccc(F)c(Cl)c1)=N2 |
| InChI | InChI=1S/C14H11ClFN3O/c15-10-6-9(2-3-11(10)16)18-14-7-20-13-5-8(17)1-4-12(13)19-14/h1-6H,7,17H2,(H,18,19) |
| InChIKey | QEJBHYHOHZCUEO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.71 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|