C16H16BNO4 — CID 563884
methyl N-[4-(1,5-dihydro-2,4,3-benzodioxaborepin-3-yl)phenyl]carbamate (PubChem CID 563884) has the molecular formula C16H16BNO4 and a molecular weight of 297.12 g/mol. Its IUPAC name is methyl N-[4-(1,5-dihydro-2,4,3-benzodioxaborepin-3-yl)phenyl]carbamate.
| Compound Name | methyl N-[4-(1,5-dihydro-2,4,3-benzodioxaborepin-3-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 563884 |
| Molecular Formula | C16H16BNO4 |
| Molecular Weight | 297.12 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | methyl N-[4-(1,5-dihydro-2,4,3-benzodioxaborepin-3-yl)phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(B2OCc3ccccc3CO2)cc1 |
| InChI | InChI=1S/C16H16BNO4/c1-20-16(19)18-15-8-6-14(7-9-15)17-21-10-12-4-2-3-5-13(12)11-22-17/h2-9H,10-11H2,1H3,(H,18,19) |
| InChIKey | CUNVGMHMBLBCFP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.12 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|