C18H18BNO4 — CID 70356259
phenyl N-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (PubChem CID 70356259) has the molecular formula C18H18BNO4 and a molecular weight of 323.16 g/mol. Its IUPAC name is phenyl N-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]carbamate.
| Compound Name | phenyl N-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 70356259 |
| Molecular Formula | C18H18BNO4 |
| Molecular Weight | 323.16 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | phenyl N-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| SMILES | C=C1OB(c2ccc(NC(=O)Oc3ccccc3)cc2)OC1(C)C |
| InChI | InChI=1S/C18H18BNO4/c1-13-18(2,3)24-19(23-13)14-9-11-15(12-10-14)20-17(21)22-16-7-5-4-6-8-16/h4-12H,1H2,2-3H3,(H,20,21) |
| InChIKey | ZOKBUXUWBYGGFJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.16 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|