C16H20B2O4 — CID 89097531
2-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]-4,4-dimethyl-5-methylidene-1,3,2-dioxaborolane (PubChem CID 89097531) has the molecular formula C16H20B2O4 and a molecular weight of 297.96 g/mol. Its IUPAC name is 2-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]-4,4-dimethyl-5-methylidene-1,3,2-dioxaborolane.
| Compound Name | 2-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]-4,4-dimethyl-5-methylidene-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 89097531 |
| Molecular Formula | C16H20B2O4 |
| Molecular Weight | 297.96 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]-4,4-dimethyl-5-methylidene-1,3,2-dioxaborolane |
| SMILES | C=C1OB(c2ccc(B3OC(=C)C(C)(C)O3)cc2)OC1(C)C |
| InChI | InChI=1S/C16H20B2O4/c1-11-15(3,4)21-17(19-11)13-7-9-14(10-8-13)18-20-12(2)16(5,6)22-18/h7-10H,1-2H2,3-6H3 |
| InChIKey | ZHWLMSKCMFGOBA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.96 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|