C16H19BN2O3 — CID 67814360
1-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-2-methoxyphenyl]-4-methylimidazole (PubChem CID 67814360) has the molecular formula C16H19BN2O3 and a molecular weight of 298.15 g/mol. Its IUPAC name is 1-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-2-methoxyphenyl]-4-methylimidazole.
| Compound Name | 1-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-2-methoxyphenyl]-4-methylimidazole |
|---|---|
| PubChem CID | 67814360 |
| Molecular Formula | C16H19BN2O3 |
| Molecular Weight | 298.15 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 1-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-2-methoxyphenyl]-4-methylimidazole |
| SMILES | C=C1OB(c2ccc(-n3cnc(C)c3)c(OC)c2)OC1(C)C |
| InChI | InChI=1S/C16H19BN2O3/c1-11-9-19(10-18-11)14-7-6-13(8-15(14)20-5)17-21-12(2)16(3,4)22-17/h6-10H,2H2,1,3-5H3 |
| InChIKey | VPYCGKYKIBNHGZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.15 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|