C17H22BNO4 — CID 67952215
2-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]-1-morpholin-4-ylethanone (PubChem CID 67952215) has the molecular formula C17H22BNO4 and a molecular weight of 315.18 g/mol. Its IUPAC name is 2-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 67952215 |
| Molecular Formula | C17H22BNO4 |
| Molecular Weight | 315.18 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]-1-morpholin-4-ylethanone |
| SMILES | C=C1OB(c2ccc(CC(=O)N3CCOCC3)cc2)OC1(C)C |
| InChI | InChI=1S/C17H22BNO4/c1-13-17(2,3)23-18(22-13)15-6-4-14(5-7-15)12-16(20)19-8-10-21-11-9-19/h4-7H,1,8-12H2,2-3H3 |
| InChIKey | MYYOADCXWRHZAD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|