C15H21NO4S — CID 16838369
1-morpholin-4-yl-2-(4-propan-2-ylsulfonylphenyl)ethanone (PubChem CID 16838369) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is 1-morpholin-4-yl-2-(4-propan-2-ylsulfonylphenyl)ethanone.
| Compound Name | 1-morpholin-4-yl-2-(4-propan-2-ylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 16838369 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 1-morpholin-4-yl-2-(4-propan-2-ylsulfonylphenyl)ethanone |
| SMILES | CC(C)S(=O)(=O)c1ccc(CC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C15H21NO4S/c1-12(2)21(18,19)14-5-3-13(4-6-14)11-15(17)16-7-9-20-10-8-16/h3-6,12H,7-11H2,1-2H3 |
| InChIKey | ZWOUAESOGCEOMN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |