C18H27NO4S — CID 90504874
1-[3-(methoxymethyl)piperidin-1-yl]-2-(4-propan-2-ylsulfonylphenyl)ethanone (PubChem CID 90504874) has the molecular formula C18H27NO4S and a molecular weight of 353.48 g/mol. Its IUPAC name is 1-[3-(methoxymethyl)piperidin-1-yl]-2-(4-propan-2-ylsulfonylphenyl)ethanone.
| Compound Name | 1-[3-(methoxymethyl)piperidin-1-yl]-2-(4-propan-2-ylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 90504874 |
| Molecular Formula | C18H27NO4S |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1-[3-(methoxymethyl)piperidin-1-yl]-2-(4-propan-2-ylsulfonylphenyl)ethanone |
| SMILES | COCC1CCCN(C(=O)Cc2ccc(S(=O)(=O)C(C)C)cc2)C1 |
| InChI | InChI=1S/C18H27NO4S/c1-14(2)24(21,22)17-8-6-15(7-9-17)11-18(20)19-10-4-5-16(12-19)13-23-3/h6-9,14,16H,4-5,10-13H2,1-3H3 |
| InChIKey | IMKATRRFFXUSDG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |