C13H16F2N2O3S — CID 119410753
1-[(3R)-3-aminopyrrolidin-1-yl]-2-[4-(difluoromethylsulfonyl)phenyl]ethanone (PubChem CID 119410753) has the molecular formula C13H16F2N2O3S and a molecular weight of 318.34 g/mol. Its IUPAC name is 1-[(3R)-3-aminopyrrolidin-1-yl]-2-[4-(difluoromethylsulfonyl)phenyl]ethanone.
| Compound Name | 1-[(3R)-3-aminopyrrolidin-1-yl]-2-[4-(difluoromethylsulfonyl)phenyl]ethanone |
|---|---|
| PubChem CID | 119410753 |
| Molecular Formula | C13H16F2N2O3S |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 1-[(3R)-3-aminopyrrolidin-1-yl]-2-[4-(difluoromethylsulfonyl)phenyl]ethanone |
| SMILES | N[C@@H]1CCN(C(=O)Cc2ccc(S(=O)(=O)C(F)F)cc2)C1 |
| InChI | InChI=1S/C13H16F2N2O3S/c14-13(15)21(19,20)11-3-1-9(2-4-11)7-12(18)17-6-5-10(16)8-17/h1-4,10,13H,5-8,16H2/t10-/m1/s1 |
| InChIKey | FFSXNYSLECOSQM-SNVBAGLBSA-N |
| XLogP | 0.79 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |