C14H20ClFN2O3S — CID 119410098
1-[(3R)-3-aminopyrrolidin-1-yl]-3-(4-fluorophenyl)sulfonylbutan-1-one;hydrochloride (PubChem CID 119410098) has the molecular formula C14H20ClFN2O3S and a molecular weight of 350.84 g/mol. Its IUPAC name is 1-[(3R)-3-aminopyrrolidin-1-yl]-3-(4-fluorophenyl)sulfonylbutan-1-one;hydrochloride.
| Compound Name | 1-[(3R)-3-aminopyrrolidin-1-yl]-3-(4-fluorophenyl)sulfonylbutan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119410098 |
| Molecular Formula | C14H20ClFN2O3S |
| Molecular Weight | 350.84 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 1-[(3R)-3-aminopyrrolidin-1-yl]-3-(4-fluorophenyl)sulfonylbutan-1-one;hydrochloride |
| SMILES | CC(CC(=O)N1CC[C@@H](N)C1)S(=O)(=O)c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C14H19FN2O3S.ClH/c1-10(8-14(18)17-7-6-12(16)9-17)21(19,20)13-4-2-11(15)3-5-13;/h2-5,10,12H,6-9,16H2,1H3;1H/t10?,12-;/m1./s1 |
| InChIKey | SAJUVKRTFIAFTP-ULIKACSMSA-N |
| XLogP | 1.36 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.84 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |