C16H24ClFN2O3S — CID 119475342
N-(4-aminocyclohexyl)-3-(4-fluorophenyl)sulfonylbutanamide;hydrochloride (PubChem CID 119475342) has the molecular formula C16H24ClFN2O3S and a molecular weight of 378.90 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-3-(4-fluorophenyl)sulfonylbutanamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-3-(4-fluorophenyl)sulfonylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119475342 |
| Molecular Formula | C16H24ClFN2O3S |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-(4-aminocyclohexyl)-3-(4-fluorophenyl)sulfonylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)NC1CCC(N)CC1)S(=O)(=O)c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C16H23FN2O3S.ClH/c1-11(23(21,22)15-8-2-12(17)3-9-15)10-16(20)19-14-6-4-13(18)5-7-14;/h2-3,8-9,11,13-14H,4-7,10,18H2,1H3,(H,19,20);1H |
| InChIKey | NZMPCEPZKMORKZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |