C17H22N2O5S — CID 126459449
N-cyclopentyl-3-[(3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]butanamide (PubChem CID 126459449) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is N-cyclopentyl-3-[(3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]butanamide.
| Compound Name | N-cyclopentyl-3-[(3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]butanamide |
|---|---|
| PubChem CID | 126459449 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-cyclopentyl-3-[(3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]butanamide |
| SMILES | CC(CC(=O)NC1CCCC1)S(=O)(=O)c1ccc2c(c1)OCC(=O)N2 |
| InChI | InChI=1S/C17H22N2O5S/c1-11(8-16(20)18-12-4-2-3-5-12)25(22,23)13-6-7-14-15(9-13)24-10-17(21)19-14/h6-7,9,11-12H,2-5,8,10H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | FRXUWMKOYHAISN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |