C18H24N2O5S — CID 126457750
N-(2-methylcyclohexyl)-3-[(3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]propanamide (PubChem CID 126457750) has the molecular formula C18H24N2O5S and a molecular weight of 380.47 g/mol. Its IUPAC name is N-(2-methylcyclohexyl)-3-[(3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]propanamide.
| Compound Name | N-(2-methylcyclohexyl)-3-[(3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]propanamide |
|---|---|
| PubChem CID | 126457750 |
| Molecular Formula | C18H24N2O5S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | N-(2-methylcyclohexyl)-3-[(3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]propanamide |
| SMILES | CC1CCCCC1NC(=O)CCS(=O)(=O)c1ccc2c(c1)OCC(=O)N2 |
| InChI | InChI=1S/C18H24N2O5S/c1-12-4-2-3-5-14(12)19-17(21)8-9-26(23,24)13-6-7-15-16(10-13)25-11-18(22)20-15/h6-7,10,12,14H,2-5,8-9,11H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | LUXIWEWHFDMUCL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |