C16H20N2O5S — CID 126459857
7-(3-oxo-3-piperidin-1-ylpropyl)sulfonyl-4H-1,4-benzoxazin-3-one (PubChem CID 126459857) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is 7-(3-oxo-3-piperidin-1-ylpropyl)sulfonyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-(3-oxo-3-piperidin-1-ylpropyl)sulfonyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 126459857 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 7-(3-oxo-3-piperidin-1-ylpropyl)sulfonyl-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cc(S(=O)(=O)CCC(=O)N3CCCCC3)ccc2N1 |
| InChI | InChI=1S/C16H20N2O5S/c19-15-11-23-14-10-12(4-5-13(14)17-15)24(21,22)9-6-16(20)18-7-2-1-3-8-18/h4-5,10H,1-3,6-9,11H2,(H,17,19) |
| InChIKey | BQWMYVXPPUPSLV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |