3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]propanoic acid

C11H11NO6S — CID 25219619

IUPAC3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]propanoic acid
SMILESO=C(O)CCS(=O)(=O)c1ccc2c(c1)NC(=O)CO2
InChIInChI=1S/C11H11NO6S/c13-10-6-18-9-2-1-7(5-8(9)12-10)19(16,17)4-3-11(14)15/h1-2,5H,3-4,6H2,(H,12,13)(H,14,15)
InChIKeySQBZLBMSIJFDRI-UHFFFAOYSA-N
MW285.28 g/mol
LogP0.27
Rot. Bonds4

About 3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]propanoic acid

3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]propanoic acid (PubChem CID 25219619) has the molecular formula C11H11NO6S and a molecular weight of 285.28 g/mol. Its IUPAC name is 3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]propanoic acid.

Molecular Properties

Compound Name3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]propanoic acid
PubChem CID25219619
Molecular FormulaC11H11NO6S
Molecular Weight285.28 g/mol
Exact Mass285.03
IUPAC Name3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]propanoic acid
SMILESO=C(O)CCS(=O)(=O)c1ccc2c(c1)NC(=O)CO2
InChIInChI=1S/C11H11NO6S/c13-10-6-18-9-2-1-7(5-8(9)12-10)19(16,17)4-3-11(14)15/h1-2,5H,3-4,6H2,(H,12,13)(H,14,15)
InChIKeySQBZLBMSIJFDRI-UHFFFAOYSA-N
XLogP0.27
TPSA109.77 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.28
LogP ≤ 50.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]propanoic acid?
The IUPAC name of 3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]propanoic acid (CID 25219619) is 3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]propanoic acid.
What is the SMILES notation for 3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]propanoic acid?
The canonical SMILES for 3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]propanoic acid is O=C(O)CCS(=O)(=O)c1ccc2c(c1)NC(=O)CO2.
What is the InChIKey of 3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]propanoic acid?
The InChIKey is SQBZLBMSIJFDRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO6S/c13-10-6-18-9-2-1-7(5-8(9)12-10)19(16,17)4-3-11(14)15/h1-2,5H,3-4,6H2,(H,12,13)(H,14,15).
What are the key properties of 3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]propanoic acid?
3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]propanoic acid has a molecular weight of 285.28 g/mol, XLogP of 0.27, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]propanoic acid is sourced from PubChem (CID 25219619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).