C10H8N2O4S — CID 116853722
2-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]acetonitrile (PubChem CID 116853722) has the molecular formula C10H8N2O4S and a molecular weight of 252.25 g/mol. Its IUPAC name is 2-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]acetonitrile.
| Compound Name | 2-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]acetonitrile |
|---|---|
| PubChem CID | 116853722 |
| Molecular Formula | C10H8N2O4S |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 2-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]acetonitrile |
| SMILES | N#CCS(=O)(=O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C10H8N2O4S/c11-3-4-17(14,15)7-1-2-9-8(5-7)12-10(13)6-16-9/h1-2,5H,4,6H2,(H,12,13) |
| InChIKey | KBNRSGOOKXWSPX-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |