C16H15NO4S — CID 158102171
6-[(4-methylphenyl)methylsulfonyl]-4H-1,4-benzoxazin-3-one (PubChem CID 158102171) has the molecular formula C16H15NO4S and a molecular weight of 317.37 g/mol. Its IUPAC name is 6-[(4-methylphenyl)methylsulfonyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(4-methylphenyl)methylsulfonyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 158102171 |
| Molecular Formula | C16H15NO4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 6-[(4-methylphenyl)methylsulfonyl]-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc(CS(=O)(=O)c2ccc3c(c2)NC(=O)CO3)cc1 |
| InChI | InChI=1S/C16H15NO4S/c1-11-2-4-12(5-3-11)10-22(19,20)13-6-7-15-14(8-13)17-16(18)9-21-15/h2-8H,9-10H2,1H3,(H,17,18) |
| InChIKey | SMYFLUMWWYLZRZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |