C16H22N2O4S — CID 126457773
N-(2,3-dimethylcyclohexyl)-3-oxo-4H-1,4-benzoxazine-7-sulfonamide (PubChem CID 126457773) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-3-oxo-4H-1,4-benzoxazine-7-sulfonamide.
| Compound Name | N-(2,3-dimethylcyclohexyl)-3-oxo-4H-1,4-benzoxazine-7-sulfonamide |
|---|---|
| PubChem CID | 126457773 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-3-oxo-4H-1,4-benzoxazine-7-sulfonamide |
| SMILES | CC1CCCC(NS(=O)(=O)c2ccc3c(c2)OCC(=O)N3)C1C |
| InChI | InChI=1S/C16H22N2O4S/c1-10-4-3-5-13(11(10)2)18-23(20,21)12-6-7-14-15(8-12)22-9-16(19)17-14/h6-8,10-11,13,18H,3-5,9H2,1-2H3,(H,17,19) |
| InChIKey | WDWUMKQGDBWLHQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |