C15H14N2O4S — CID 110504134
4-methyl-N-(3-oxo-4H-1,4-benzoxazin-7-yl)benzenesulfonamide (PubChem CID 110504134) has the molecular formula C15H14N2O4S and a molecular weight of 318.35 g/mol. Its IUPAC name is 4-methyl-N-(3-oxo-4H-1,4-benzoxazin-7-yl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(3-oxo-4H-1,4-benzoxazin-7-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 110504134 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 4-methyl-N-(3-oxo-4H-1,4-benzoxazin-7-yl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc3c(c2)OCC(=O)N3)cc1 |
| InChI | InChI=1S/C15H14N2O4S/c1-10-2-5-12(6-3-10)22(19,20)17-11-4-7-13-14(8-11)21-9-15(18)16-13/h2-8,17H,9H2,1H3,(H,16,18) |
| InChIKey | SSOLBNIXIPCSFR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |