C17H18N2O6S2 — CID 167344291
6-ethylsulfonyl-N-(4-methylphenyl)-3-oxo-4H-1,4-benzoxazine-8-sulfonamide (PubChem CID 167344291) has the molecular formula C17H18N2O6S2 and a molecular weight of 410.47 g/mol. Its IUPAC name is 6-ethylsulfonyl-N-(4-methylphenyl)-3-oxo-4H-1,4-benzoxazine-8-sulfonamide.
| Compound Name | 6-ethylsulfonyl-N-(4-methylphenyl)-3-oxo-4H-1,4-benzoxazine-8-sulfonamide |
|---|---|
| PubChem CID | 167344291 |
| Molecular Formula | C17H18N2O6S2 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 6-ethylsulfonyl-N-(4-methylphenyl)-3-oxo-4H-1,4-benzoxazine-8-sulfonamide |
| SMILES | CCS(=O)(=O)c1cc2c(c(S(=O)(=O)Nc3ccc(C)cc3)c1)OCC(=O)N2 |
| InChI | InChI=1S/C17H18N2O6S2/c1-3-26(21,22)13-8-14-17(25-10-16(20)18-14)15(9-13)27(23,24)19-12-6-4-11(2)5-7-12/h4-9,19H,3,10H2,1-2H3,(H,18,20) |
| InChIKey | PFPWMVWUVVSTLM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |