C17H22N2O4S2 — CID 46276291
N-cyclopentyl-3-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]butanamide (PubChem CID 46276291) has the molecular formula C17H22N2O4S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-cyclopentyl-3-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]butanamide.
| Compound Name | N-cyclopentyl-3-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]butanamide |
|---|---|
| PubChem CID | 46276291 |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-cyclopentyl-3-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]butanamide |
| SMILES | CC(CC(=O)NC1CCCC1)S(=O)(=O)c1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C17H22N2O4S2/c1-11(8-16(20)18-12-4-2-3-5-12)25(22,23)13-6-7-15-14(9-13)19-17(21)10-24-15/h6-7,9,11-12H,2-5,8,10H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | LZGHRWDRUSIWKP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |