C20H22N2O5S2 — CID 126459303
N-(4-ethoxyphenyl)-3-[(3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]butanamide (PubChem CID 126459303) has the molecular formula C20H22N2O5S2 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-3-[(3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]butanamide.
| Compound Name | N-(4-ethoxyphenyl)-3-[(3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]butanamide |
|---|---|
| PubChem CID | 126459303 |
| Molecular Formula | C20H22N2O5S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | N-(4-ethoxyphenyl)-3-[(3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]butanamide |
| SMILES | CCOc1ccc(NC(=O)CC(C)S(=O)(=O)c2ccc3c(c2)SCC(=O)N3)cc1 |
| InChI | InChI=1S/C20H22N2O5S2/c1-3-27-15-6-4-14(5-7-15)21-19(23)10-13(2)29(25,26)16-8-9-17-18(11-16)28-12-20(24)22-17/h4-9,11,13H,3,10,12H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | BZIJGTDFDBWSQA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |