C20H28N2O4S2 — CID 20911788
N-cyclooctyl-3-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]butanamide (PubChem CID 20911788) has the molecular formula C20H28N2O4S2 and a molecular weight of 424.59 g/mol. Its IUPAC name is N-cyclooctyl-3-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]butanamide.
| Compound Name | N-cyclooctyl-3-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]butanamide |
|---|---|
| PubChem CID | 20911788 |
| Molecular Formula | C20H28N2O4S2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | N-cyclooctyl-3-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]butanamide |
| SMILES | CC(CC(=O)NC1CCCCCCC1)S(=O)(=O)c1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C20H28N2O4S2/c1-14(11-19(23)21-15-7-5-3-2-4-6-8-15)28(25,26)16-9-10-18-17(12-16)22-20(24)13-27-18/h9-10,12,14-15H,2-8,11,13H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | BRWWGAYFXYARRZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |