C19H19ClN2O6S — CID 126459300
N-(5-chloro-2-methoxyphenyl)-3-[(3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]butanamide (PubChem CID 126459300) has the molecular formula C19H19ClN2O6S and a molecular weight of 438.89 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-3-[(3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]butanamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-3-[(3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]butanamide |
|---|---|
| PubChem CID | 126459300 |
| Molecular Formula | C19H19ClN2O6S |
| Molecular Weight | 438.89 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-3-[(3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]butanamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CC(C)S(=O)(=O)c1ccc2c(c1)OCC(=O)N2 |
| InChI | InChI=1S/C19H19ClN2O6S/c1-11(7-18(23)22-15-8-12(20)3-6-16(15)27-2)29(25,26)13-4-5-14-17(9-13)28-10-19(24)21-14/h3-6,8-9,11H,7,10H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | KKDHCZAFNHSPHJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.89 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |