C20H22N2O7S — CID 20909855
N-(2,5-dimethoxyphenyl)-3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]butanamide (PubChem CID 20909855) has the molecular formula C20H22N2O7S and a molecular weight of 434.47 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]butanamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]butanamide |
|---|---|
| PubChem CID | 20909855 |
| Molecular Formula | C20H22N2O7S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]butanamide |
| SMILES | COc1ccc(OC)c(NC(=O)CC(C)S(=O)(=O)c2ccc3c(c2)NC(=O)CO3)c1 |
| InChI | InChI=1S/C20H22N2O7S/c1-12(8-19(23)21-15-9-13(27-2)4-6-17(15)28-3)30(25,26)14-5-7-18-16(10-14)22-20(24)11-29-18/h4-7,9-10,12H,8,11H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | XCGMECMHDYVAPL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |