C19H30ClFN2O3S — CID 119619656
N-[2-(cycloheptylamino)ethyl]-3-(4-fluorophenyl)sulfonylbutanamide;hydrochloride (PubChem CID 119619656) has the molecular formula C19H30ClFN2O3S and a molecular weight of 420.98 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-3-(4-fluorophenyl)sulfonylbutanamide;hydrochloride.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-3-(4-fluorophenyl)sulfonylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119619656 |
| Molecular Formula | C19H30ClFN2O3S |
| Molecular Weight | 420.98 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-3-(4-fluorophenyl)sulfonylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)NCCNC1CCCCCC1)S(=O)(=O)c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C19H29FN2O3S.ClH/c1-15(26(24,25)18-10-8-16(20)9-11-18)14-19(23)22-13-12-21-17-6-4-2-3-5-7-17;/h8-11,15,17,21H,2-7,12-14H2,1H3,(H,22,23);1H |
| InChIKey | KXRAXQBPHDKFMI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.98 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|