C14H19NO3 — CID 60700942
2-(3-methoxy-4-methylphenyl)-1-morpholin-4-ylethanone (PubChem CID 60700942) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-(3-methoxy-4-methylphenyl)-1-morpholin-4-ylethanone.
| Compound Name | 2-(3-methoxy-4-methylphenyl)-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 60700942 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 2-(3-methoxy-4-methylphenyl)-1-morpholin-4-ylethanone |
| SMILES | COc1cc(CC(=O)N2CCOCC2)ccc1C |
| InChI | InChI=1S/C14H19NO3/c1-11-3-4-12(9-13(11)17-2)10-14(16)15-5-7-18-8-6-15/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | DRXIKHVBWLQWOC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |