C16H22BNO3 — CID 86698592
1-(azetidin-1-yl)-2-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]ethanone (PubChem CID 86698592) has the molecular formula C16H22BNO3 and a molecular weight of 287.17 g/mol. Its IUPAC name is 1-(azetidin-1-yl)-2-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]ethanone.
| Compound Name | 1-(azetidin-1-yl)-2-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 86698592 |
| Molecular Formula | C16H22BNO3 |
| Molecular Weight | 287.17 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 1-(azetidin-1-yl)-2-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]ethanone |
| SMILES | CC1(C)COB(c2ccc(CC(=O)N3CCC3)cc2)OC1 |
| InChI | InChI=1S/C16H22BNO3/c1-16(2)11-20-17(21-12-16)14-6-4-13(5-7-14)10-15(19)18-8-3-9-18/h4-7H,3,8-12H2,1-2H3 |
| InChIKey | UBWOQVHDHOYSMF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.17 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|