C14H16BNO3 — CID 89451321
6-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 89451321) has the molecular formula C14H16BNO3 and a molecular weight of 257.10 g/mol. Its IUPAC name is 6-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 89451321 |
| Molecular Formula | C14H16BNO3 |
| Molecular Weight | 257.10 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 6-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | C=C1OB(c2ccc3c(c2)CCC(=O)N3)OC1(C)C |
| InChI | InChI=1S/C14H16BNO3/c1-9-14(2,3)19-15(18-9)11-5-6-12-10(8-11)4-7-13(17)16-12/h5-6,8H,1,4,7H2,2-3H3,(H,16,17) |
| InChIKey | PVMWZFAZTDAQQZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.10 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|