C11H11NO2 — CID 95436529
6-[(2R)-oxiran-2-yl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 95436529) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 6-[(2R)-oxiran-2-yl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[(2R)-oxiran-2-yl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 95436529 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 6-[(2R)-oxiran-2-yl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc([C@@H]3CO3)ccc2N1 |
| InChI | InChI=1S/C11H11NO2/c13-11-4-2-7-5-8(10-6-14-10)1-3-9(7)12-11/h1,3,5,10H,2,4,6H2,(H,12,13)/t10-/m0/s1 |
| InChIKey | KDWKPOXQEWDDRS-JTQLQIEISA-N |
| XLogP | 1.64 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|