C12H14N2O2 — CID 82472049
6-(1,3-oxazolidin-5-yl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 82472049) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 6-(1,3-oxazolidin-5-yl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(1,3-oxazolidin-5-yl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 82472049 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 6-(1,3-oxazolidin-5-yl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C3CNCO3)ccc2N1 |
| InChI | InChI=1S/C12H14N2O2/c15-12-4-2-8-5-9(1-3-10(8)14-12)11-6-13-7-16-11/h1,3,5,11,13H,2,4,6-7H2,(H,14,15) |
| InChIKey | MVZDAOISANVEAN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |