C14H18N2O2 — CID 116927838
6-(morpholin-2-ylmethyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 116927838) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 6-(morpholin-2-ylmethyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(morpholin-2-ylmethyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 116927838 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 6-(morpholin-2-ylmethyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(CC3CNCCO3)ccc2N1 |
| InChI | InChI=1S/C14H18N2O2/c17-14-4-2-11-7-10(1-3-13(11)16-14)8-12-9-15-5-6-18-12/h1,3,7,12,15H,2,4-6,8-9H2,(H,16,17) |
| InChIKey | VPXYGVJCZSELEZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |