C13H16N2O2 — CID 82289623
6-morpholin-2-yl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 82289623) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 6-morpholin-2-yl-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-morpholin-2-yl-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 82289623 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 6-morpholin-2-yl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C3CNCCO3)ccc2N1 |
| InChI | InChI=1S/C13H16N2O2/c16-13-4-2-9-7-10(1-3-11(9)15-13)12-8-14-5-6-17-12/h1,3,7,12,14H,2,4-6,8H2,(H,15,16) |
| InChIKey | FPODLINTVLXENX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |