C12H16N2OS — CID 116998976
2-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)morpholine (PubChem CID 116998976) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)morpholine.
| Compound Name | 2-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)morpholine |
|---|---|
| PubChem CID | 116998976 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)morpholine |
| SMILES | c1cc2c(cc1C1CNCCO1)SCCN2 |
| InChI | InChI=1S/C12H16N2OS/c1-2-10-12(16-6-4-14-10)7-9(1)11-8-13-3-5-15-11/h1-2,7,11,13-14H,3-6,8H2 |
| InChIKey | BZBXGQLFNKZFII-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |