C29H30B2O4 — CID 88553179
2-[8-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)chrysen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 88553179) has the molecular formula C29H30B2O4 and a molecular weight of 464.18 g/mol. Its IUPAC name is 2-[8-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)chrysen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[8-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)chrysen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 88553179 |
| Molecular Formula | C29H30B2O4 |
| Molecular Weight | 464.18 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | 2-[8-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)chrysen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=C1OB(c2ccc3c(ccc4c5ccc(B6OC(C)(C)C(C)(C)O6)cc5ccc34)c2)OC1(C)C |
| InChI | InChI=1S/C29H30B2O4/c1-18-27(2,3)33-30(32-18)21-10-14-23-19(16-21)8-12-26-24-15-11-22(17-20(24)9-13-25(23)26)31-34-28(4,5)29(6,7)35-31/h8-17H,1H2,2-7H3 |
| InChIKey | WGLDVKWMWOMOEN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.18 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|