C17H18BNO2 — CID 133062626
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carbonitrile (PubChem CID 133062626) has the molecular formula C17H18BNO2 and a molecular weight of 279.15 g/mol. Its IUPAC name is 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carbonitrile.
| Compound Name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 133062626 |
| Molecular Formula | C17H18BNO2 |
| Molecular Weight | 279.15 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carbonitrile |
| SMILES | CC1(C)OB(c2ccc3c(C#N)cccc3c2)OC1(C)C |
| InChI | InChI=1S/C17H18BNO2/c1-16(2)17(3,4)21-18(20-16)14-8-9-15-12(10-14)6-5-7-13(15)11-19/h5-10H,1-4H3 |
| InChIKey | YMHIYMVVWWPTMK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.15 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|